| |
 |
Beaverite Mineral Data
|
|
|
General Beaverite Information
|
 Chemical Formula: |
PbCu++(Fe+++,Al)2(SO4)2(OH)6 |
| Composition: |
Molecular Weight = 662.18 gm |
| |
Aluminum 2.04 % Al 3.85 % Al2O3 |
| |
Iron 12.65 % Fe 18.09 % Fe2O3 |
| |
Copper 9.60 % Cu 12.01 % CuO |
| |
Hydrogen 0.91 % H 8.16 % H2O |
| |
Lead 31.29 % Pb 33.71 % PbO |
| |
Sulfur 9.69 % S 24.18 % SO3 |
| |
Oxygen 33.83 % O |
| |
______ ______ |
| |
100.00 % 100.00 % = TOTAL OXIDE |
| Empirical Formula: |
PbCuFe3+1.5Al0.5(SO4)2(OH)6 |
| Environment: |
Secondary mineral in the oxidized zone of Pb-Cu deposits. |
| IMA Status: |
Valid Species (Pre-IMA) 1911 |
| Locality: |
Horn Silver mine, Beaver County, Utah, USA. Link to MinDat.org Location Data. |
| Name Origin: |
Named for the locality. |
| Name Pronunciation: |
Beaverite + Pronunciation  |
| Synonym: |
ICSD 67682 |
| |
PDF 17-476 |
| |