| |
 |
Cascandite Mineral Data
|
|
|
General Cascandite Information
|
 Chemical Formula: |
Ca(Sc,Fe++)Si3O8(OH) |
| Composition: |
Molecular Weight = 317.02 gm |
| |
Calcium 12.64 % Ca 17.69 % CaO |
| |
Scandium 10.64 % Sc 16.31 % Sc2O3 |
| |
Iron 4.40 % Fe 5.67 % FeO |
| |
Silicon 26.58 % Si 56.86 % SiO2 |
| |
Hydrogen 0.32 % H 2.84 % H2O |
| |
Oxygen 45.42 % O |
| |
______ ______ |
| |
100.00 % 99.37 % = TOTAL OXIDE |
| Empirical Formula: |
CaSc0.75Fe2+0.25Si3O8(OH) |
| Environment: |
In miarolitic cavities in granite. |
| IMA Status: |
Approved IMA 1982 |
| Locality: |
From the Diverio quarry, Mt. Mottarone, near Baveno, Piedmont, Italy. Link to MinDat.org Location Data. |
| Name Origin: |
Named for CAlcium and SCANDium in the composition. |
| Synonym: |
ICSD 17047 |
| |
PDF 35-541 |
| |