| |
 |
Ehrleite Mineral Data
|
|
|
General Ehrleite Information
|
 Chemical Formula: |
Ca2ZnBe(PO4)2(PO3,OH)•4(H2O) |
| Composition: |
Molecular Weight = 480.04 gm |
| |
Calcium 16.70 % Ca 23.36 % CaO |
| |
Beryllium 1.88 % Be 5.21 % BeO |
| |
Zinc 13.62 % Zn 16.95 % ZnO |
| |
Phosphorus 17.74 % P 40.66 % P2O5 |
| |
Hydrogen 1.73 % H 15.48 % H2O |
| |
Oxygen 48.33 % O |
| |
______ ______ |
| |
100.00 % 101.67 % = TOTAL OXIDE |
| Empirical Formula: |
Ca2ZnBe(PO4)2(PO3)0.75(OH)0.25•4(H2O) |
| IMA Status: |
Approved IMA 1985 |
| Locality: |
Tip Top mine, Custer County, South Dakota. Link to MinDat.org Location Data. |
| Name Origin: |
Named for Howard Ehrle of Miles City, Montana, who found the mineral. |
| Name Pronunciation: |
Ehrleite  |
| Synonym: |
ICSD 202481 |
| |
PDF 38-402 |
| |