|
![Mineralogy Database Mineralogy Database](/images/Hedyphane_Crystal.gif) |
Lusungite Mineral Data
|
|
|
General Lusungite Information
|
Chemical Formula: |
(Sr,Pb)Fe+++3(PO4)2(OH)5•(H2O) |
Composition: |
Molecular Weight = 578.05 gm |
|
Strontium 11.37 % Sr 13.44 % SrO |
|
Iron 28.98 % Fe 41.44 % Fe2O3 |
|
Phosphorus 10.72 % P 24.56 % P2O5 |
|
Hydrogen 1.22 % H 10.91 % H2O |
|
Lead 8.96 % Pb 10.35 % PbO2 |
|
Oxygen 38.75 % O |
|
______ ______ |
|
100.00 % 100.69 % = TOTAL OXIDE |
Empirical Formula: |
Sr0.75Pb0.25Fe3+3(PO4)2(OH)5•(H2O) |
Environment: |
Found with iron oxyhydroxides ("limonite"). Discredited as being equal to benauite. |
IMA Status: |
Discredited IMA 1983 - Valid Species (Pre-IMA) 1958 |
Locality: |
Kookobo, Kivu, Zaire. Link to MinDat.org Location Data. |
Name Origin: |
Named in 1958 for the Lusungu River, Zaire. |
Synonym: |
Discredited IMA 1995 |
|