| |
 |
Orpheite Mineral Data
|
|
|
General Orpheite Information
|
 Chemical Formula: |
PbAl3(PO4,SO4)2(OH)6 (?) |
| Composition: |
Molecular Weight = 580.68 gm |
| |
Aluminum 13.94 % Al 26.34 % Al2O3 |
| |
Phosphorus 8.00 % P 18.33 % P2O5 |
| |
Hydrogen 1.04 % H 9.31 % H2O |
| |
Lead 35.68 % Pb 38.44 % PbO |
| |
Sulfur 2.76 % S 6.89 % SO3 |
| |
Oxygen 38.57 % O |
| |
______ ______ |
| |
100.00 % 99.31 % = TOTAL OXIDE |
| Empirical Formula: |
PbAl3(PO4)1.5(SO4)0.5(OH)6 |
| Environment: |
Secondary mineral in the oxidized zone of a polymetallic deposit. |
| IMA Status: |
Approved IMA 1971 |
| Locality: |
Madjarovo Pb-Zn deposit, eastern Rhodopes Mountains, 60 km southeast of Haskovo, Bulgaria. Link to MinDat.org Location Data. |
| Name Origin: |
Named for Orpheus, mythical singer in the Rhodopes Mountains. |
| Name Pronunciation: |
Orpheite  |
| |