| |
 |
Sidpietersite Mineral Data
|
|
|
General Sidpietersite Information
|
 Chemical Formula: |
Pb++4(S++++++O3S--)O2(OH)2 |
| Composition: |
Molecular Weight = 1,006.94 gm |
| |
Hydrogen 0.20 % H 1.79 % H2O |
| |
Lead 82.31 % Pb 88.66 % PbO |
| |
Sulfur 6.37 % S |
| |
Oxygen 11.12 % O |
| |
______ ______ |
| |
100.00 % 96.82 % = TOTAL OXIDE |
| Empirical Formula: |
Pb4(SO3)SO2(OH)2 |
| Environment: |
Secondary mineral. |
| IMA Status: |
Approved IMA 1998 (Dana # Added) |
| Locality: |
Single specimen collected from the 40th to 44th levels of the Tsumeb mine, Tsumeb, Namibia, Link to MinDat.org Location Data. |
| Name Origin: |
Named after Sidney Pieters (1920-2003), of Windhoek, Namibia for his outstanding contributions to Namibian mineralogy. |
| Synonym: |
ICSD 87736 |
| |
IMA1998-036 |
| |
Lead Thiosulfate |
| |