| |
 |
Sreinite Mineral Data
|
|
|
General Sreinite Information
|
 Chemical Formula: |
Pb2(UO2)11(BiO)8(PO4)5(OH)19•6(H2O) |
| Composition: |
Molecular Weight = 6,090.63 gm |
| |
Uranium 42.99 % U 48.77 % UO2 |
| |
Bismuth 27.45 % Bi 30.60 % Bi2O3 |
| |
Phosphorus 2.54 % P 5.83 % P2O5 |
| |
Hydrogen 0.51 % H 4.58 % H2O |
| |
Lead 6.80 % Pb 7.33 % PbO |
| |
Oxygen 19.70 % O |
| |
______ ______ |
| |
100.00 % 97.11 % = TOTAL OXIDE |
| Empirical Formula: |
Pb2(UO2)11Bi8O8(PO4)5(OH)19•6(H2O) |
| Environment: |
P-dominant analogue of asselbornite |
| IMA Status: |
Proposed IMA 2004 (Dana # Added) |
| Locality: |
Horn� Hal�e, Kru�ne Hory Mts., Czech Republic Link to MinDat.org Location Data. |
| Name Origin: |
Commission on New Minerals, Nomenclature and Classification (CNMNC) |
| Synonym: |
IMA2004-022 |
| |