| |
 |
IMA2009-013 Mineral Data
|
|
|
General IMA2009-013 Information
|
 Chemical Formula: |
NaCe2(CO3)2[(CO3)1-xF2x]F |
| Composition: |
Molecular Weight = 496.74 gm |
| |
Sodium 4.63 % Na 6.24 % Na2O |
| |
Cerium 56.41 % Ce 66.08 % Ce2O3 |
| |
Carbon 6.65 % C 24.36 % CO2 |
| |
Oxygen 26.57 % O |
| |
Fluorine 5.74 % F 5.74 % F |
| |
- %
F -2.42 % -O=F2 |
| |
______ ______ |
| |
100.00 % 100.00 % = TOTAL OXIDE |
| Empirical Formula: |
NaCe2(CO3)2(CO3)0.75F0.5F |
| Environment: |
Related to lukechangite-(Ce), cordylite-(Ce), huanghoite-(Ce) and horv�thite-(Y). |
| IMA Status: |
Proposed IMA 2009 |
| Locality: |
Mont Saint-Hilaire, Quebec, Canada. Link to MinDat.org Location Data. |
| Name Origin: |
Commission on New Minerals, Nomenclature and Classification (CNMNC) |
| |